C41H55N7O6 — CID 19004129
benzyl N-(2-amino-2-oxoethyl)-N-[2-[[4-(dipentylcarbamoyl)-1-(diphenylcarbamoyl)piperazine-2-carbonyl]amino]ethyl]carbamate (PubChem CID 19004129) has the molecular formula C41H55N7O6 and a molecular weight of 741.93 g/mol. Its IUPAC name is benzyl N-(2-amino-2-oxoethyl)-N-[2-[[4-(dipentylcarbamoyl)-1-(diphenylcarbamoyl)piperazine-2-carbonyl]amino]ethyl]carbamate.
| Compound Name | benzyl N-(2-amino-2-oxoethyl)-N-[2-[[4-(dipentylcarbamoyl)-1-(diphenylcarbamoyl)piperazine-2-carbonyl]amino]ethyl]carbamate |
|---|---|
| PubChem CID | 19004129 |
| Molecular Formula | C41H55N7O6 |
| Molecular Weight | 741.93 g/mol |
| Exact Mass | 741.42 |
| IUPAC Name | benzyl N-(2-amino-2-oxoethyl)-N-[2-[[4-(dipentylcarbamoyl)-1-(diphenylcarbamoyl)piperazine-2-carbonyl]amino]ethyl]carbamate |
| SMILES | CCCCCN(CCCCC)C(=O)N1CCN(C(=O)N(c2ccccc2)c2ccccc2)C(C(=O)NCCN(CC(N)=O)C(=O)OCc2ccccc2)C1 |
| InChI | InChI=1S/C41H55N7O6/c1-3-5-16-25-44(26-17-6-4-2)39(51)45-28-29-47(40(52)48(34-20-12-8-13-21-34)35-22-14-9-15-23-35)36(30-45)38(50)43-24-27-46(31-37(42)49)41(53)54-32-33-18-10-7-11-19-33/h7-15,18-23,36H,3-6,16-17,24-32H2,1-2H3,(H2,42,49)(H,43,50) |
| InChIKey | XZKYROQPUCPYJC-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 148.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 741.93 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|