C16H23N3O2 — CID 86911818
1-acetyl-N-[2-(N-methylanilino)ethyl]pyrrolidine-2-carboxamide (PubChem CID 86911818) has the molecular formula C16H23N3O2 and a molecular weight of 289.38 g/mol. Its IUPAC name is 1-acetyl-N-[2-(N-methylanilino)ethyl]pyrrolidine-2-carboxamide.
| Compound Name | 1-acetyl-N-[2-(N-methylanilino)ethyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 86911818 |
| Molecular Formula | C16H23N3O2 |
| Molecular Weight | 289.38 g/mol |
| Exact Mass | 289.18 |
| IUPAC Name | 1-acetyl-N-[2-(N-methylanilino)ethyl]pyrrolidine-2-carboxamide |
| SMILES | CC(=O)N1CCCC1C(=O)NCCN(C)c1ccccc1 |
| InChI | InChI=1S/C16H23N3O2/c1-13(20)19-11-6-9-15(19)16(21)17-10-12-18(2)14-7-4-3-5-8-14/h3-5,7-8,15H,6,9-12H2,1-2H3,(H,17,21) |
| InChIKey | KTZSXDJDQUNZNC-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.38 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |