C18H17NO3S — CID 57126744
(2S)-2-[[(1S)-1-(1-benzothiophen-2-yl)ethyl]amino]oxy-2-phenylacetic acid (PubChem CID 57126744) has the molecular formula C18H17NO3S and a molecular weight of 327.41 g/mol. Its IUPAC name is (2S)-2-[[(1S)-1-(1-benzothiophen-2-yl)ethyl]amino]oxy-2-phenylacetic acid.
| Compound Name | (2S)-2-[[(1S)-1-(1-benzothiophen-2-yl)ethyl]amino]oxy-2-phenylacetic acid |
|---|---|
| PubChem CID | 57126744 |
| Molecular Formula | C18H17NO3S |
| Molecular Weight | 327.41 g/mol |
| Exact Mass | 327.09 |
| IUPAC Name | (2S)-2-[[(1S)-1-(1-benzothiophen-2-yl)ethyl]amino]oxy-2-phenylacetic acid |
| SMILES | C[C@H](NO[C@H](C(=O)O)c1ccccc1)c1cc2ccccc2s1 |
| InChI | InChI=1S/C18H17NO3S/c1-12(16-11-14-9-5-6-10-15(14)23-16)19-22-17(18(20)21)13-7-3-2-4-8-13/h2-12,17,19H,1H3,(H,20,21)/t12-,17-/m0/s1 |
| InChIKey | XRYGMNZMCLQZDW-SJCJKPOMSA-N |
| XLogP | 4.31 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.41 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|