C19H26N2O — CID 134926908
2-(benzhydrylamino)oxy-N,N-diethylethanamine (PubChem CID 134926908) has the molecular formula C19H26N2O and a molecular weight of 298.43 g/mol. Its IUPAC name is 2-(benzhydrylamino)oxy-N,N-diethylethanamine.
| Compound Name | 2-(benzhydrylamino)oxy-N,N-diethylethanamine |
|---|---|
| PubChem CID | 134926908 |
| Molecular Formula | C19H26N2O |
| Molecular Weight | 298.43 g/mol |
| Exact Mass | 298.20 |
| IUPAC Name | 2-(benzhydrylamino)oxy-N,N-diethylethanamine |
| SMILES | CCN(CC)CCONC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C19H26N2O/c1-3-21(4-2)15-16-22-20-19(17-11-7-5-8-12-17)18-13-9-6-10-14-18/h5-14,19-20H,3-4,15-16H2,1-2H3 |
| InChIKey | CPXGOFNISYSROZ-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.43 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|