C8H16OS2 — CID 134926980
(1R,2S)-2-pentyl-1,3-dithiolane 1-oxide (PubChem CID 134926980) has the molecular formula C8H16OS2 and a molecular weight of 192.35 g/mol. Its IUPAC name is (1R,2S)-2-pentyl-1,3-dithiolane 1-oxide.
| Compound Name | (1R,2S)-2-pentyl-1,3-dithiolane 1-oxide |
|---|---|
| PubChem CID | 134926980 |
| Molecular Formula | C8H16OS2 |
| Molecular Weight | 192.35 g/mol |
| Exact Mass | 192.06 |
| IUPAC Name | (1R,2S)-2-pentyl-1,3-dithiolane 1-oxide |
| SMILES | CCCCC[C@H]1SCC[S@]1=O |
| InChI | InChI=1S/C8H16OS2/c1-2-3-4-5-8-10-6-7-11(8)9/h8H,2-7H2,1H3/t8-,11+/m0/s1 |
| InChIKey | DZRVEKMTUVBKKX-GZMMTYOYSA-N |
| XLogP | 2.39 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.35 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|