About 1-hexylsulfinylhexane
1-hexylsulfinylhexane (PubChem CID 16593) has the molecular formula C12H26OS
and a molecular weight of 218.41 g/mol. Its IUPAC name is 1-hexylsulfinylhexane.
Molecular Properties
| Compound Name | 1-hexylsulfinylhexane |
| PubChem CID | 16593 |
| Molecular Formula | C12H26OS |
| Molecular Weight | 218.41 g/mol |
| Exact Mass | 218.17 |
| IUPAC Name | 1-hexylsulfinylhexane |
| SMILES | CCCCCCS(=O)CCCCCC |
| InChI | InChI=1S/C12H26OS/c1-3-5-7-9-11-14(13)12-10-8-6-4-2/h3-12H2,1-2H3 |
| InChIKey | DLEXINLCPPEMMI-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.41 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-hexylsulfinylhexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-hexylsulfinylhexane?
The IUPAC name of 1-hexylsulfinylhexane (CID 16593) is 1-hexylsulfinylhexane.
What is the SMILES notation for 1-hexylsulfinylhexane?
The canonical SMILES for 1-hexylsulfinylhexane is CCCCCCS(=O)CCCCCC.
What is the InChIKey of 1-hexylsulfinylhexane?
The InChIKey is DLEXINLCPPEMMI-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H26OS/c1-3-5-7-9-11-14(13)12-10-8-6-4-2/h3-12H2,1-2H3.
What are the key properties of 1-hexylsulfinylhexane?
1-hexylsulfinylhexane has a molecular weight of 218.41 g/mol, XLogP of 3.90, 10 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-hexylsulfinylhexane is sourced from PubChem (CID 16593), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).