About 1-methylsulfinyldodecane
1-methylsulfinyldodecane (PubChem CID 18319) has the molecular formula C13H28OS
and a molecular weight of 232.43 g/mol. Its IUPAC name is 1-methylsulfinyldodecane.
Molecular Properties
| Compound Name | 1-methylsulfinyldodecane |
| PubChem CID | 18319 |
| Molecular Formula | C13H28OS |
| Molecular Weight | 232.43 g/mol |
| Exact Mass | 232.19 |
| IUPAC Name | 1-methylsulfinyldodecane |
| SMILES | CCCCCCCCCCCCS(C)=O |
| InChI | InChI=1S/C13H28OS/c1-3-4-5-6-7-8-9-10-11-12-13-15(2)14/h3-13H2,1-2H3 |
| InChIKey | CJPDBKNETSCHCH-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.43 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-methylsulfinyldodecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methylsulfinyldodecane?
The IUPAC name of 1-methylsulfinyldodecane (CID 18319) is 1-methylsulfinyldodecane.
What is the SMILES notation for 1-methylsulfinyldodecane?
The canonical SMILES for 1-methylsulfinyldodecane is CCCCCCCCCCCCS(C)=O.
What is the InChIKey of 1-methylsulfinyldodecane?
The InChIKey is CJPDBKNETSCHCH-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H28OS/c1-3-4-5-6-7-8-9-10-11-12-13-15(2)14/h3-13H2,1-2H3.
What are the key properties of 1-methylsulfinyldodecane?
1-methylsulfinyldodecane has a molecular weight of 232.43 g/mol, XLogP of 4.29, 11 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methylsulfinyldodecane is sourced from PubChem (CID 18319), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).