C22H27NO — CID 134927041
(E)-1-phenyl-N-(1-phenylbutoxy)-N-prop-2-enylprop-1-en-2-amine (PubChem CID 134927041) has the molecular formula C22H27NO and a molecular weight of 321.46 g/mol. Its IUPAC name is (E)-1-phenyl-N-(1-phenylbutoxy)-N-prop-2-enylprop-1-en-2-amine.
| Compound Name | (E)-1-phenyl-N-(1-phenylbutoxy)-N-prop-2-enylprop-1-en-2-amine |
|---|---|
| PubChem CID | 134927041 |
| Molecular Formula | C22H27NO |
| Molecular Weight | 321.46 g/mol |
| Exact Mass | 321.21 |
| IUPAC Name | (E)-1-phenyl-N-(1-phenylbutoxy)-N-prop-2-enylprop-1-en-2-amine |
| SMILES | C=CCN(OC(CCC)c1ccccc1)/C(C)=C/c1ccccc1 |
| InChI | InChI=1S/C22H27NO/c1-4-12-22(21-15-10-7-11-16-21)24-23(17-5-2)19(3)18-20-13-8-6-9-14-20/h5-11,13-16,18,22H,2,4,12,17H2,1,3H3/b19-18+ |
| InChIKey | BCTGDMLHDRYLQZ-VHEBQXMUSA-N |
| XLogP | 6.01 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.46 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|