C12H26N2O4S2 — CID 134927361
N-[(E)-4-(tert-butylsulfonylamino)but-2-enyl]-2-methylpropane-2-sulfonamide (PubChem CID 134927361) has the molecular formula C12H26N2O4S2 and a molecular weight of 326.48 g/mol. Its IUPAC name is N-[(E)-4-(tert-butylsulfonylamino)but-2-enyl]-2-methylpropane-2-sulfonamide.
| Compound Name | N-[(E)-4-(tert-butylsulfonylamino)but-2-enyl]-2-methylpropane-2-sulfonamide |
|---|---|
| PubChem CID | 134927361 |
| Molecular Formula | C12H26N2O4S2 |
| Molecular Weight | 326.48 g/mol |
| Exact Mass | 326.13 |
| IUPAC Name | N-[(E)-4-(tert-butylsulfonylamino)but-2-enyl]-2-methylpropane-2-sulfonamide |
| SMILES | CC(C)(C)S(=O)(=O)NC/C=C/CNS(=O)(=O)C(C)(C)C |
| InChI | InChI=1S/C12H26N2O4S2/c1-11(2,3)19(15,16)13-9-7-8-10-14-20(17,18)12(4,5)6/h7-8,13-14H,9-10H2,1-6H3/b8-7+ |
| InChIKey | ZRDAFLBTVNULMZ-BQYQJAHWSA-N |
| XLogP | 0.98 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.48 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|