C16H28OS — CID 134927825
(3R,5S)-1-butylsulfinyl-3,5-dimethyladamantane (PubChem CID 134927825) has the molecular formula C16H28OS and a molecular weight of 268.47 g/mol. Its IUPAC name is (3R,5S)-1-butylsulfinyl-3,5-dimethyladamantane.
| Compound Name | (3R,5S)-1-butylsulfinyl-3,5-dimethyladamantane |
|---|---|
| PubChem CID | 134927825 |
| Molecular Formula | C16H28OS |
| Molecular Weight | 268.47 g/mol |
| Exact Mass | 268.19 |
| IUPAC Name | (3R,5S)-1-butylsulfinyl-3,5-dimethyladamantane |
| SMILES | CCCCS(=O)C12CC3C[C@@](C)(C1)C[C@](C)(C3)C2 |
| InChI | InChI=1S/C16H28OS/c1-4-5-6-18(17)16-9-13-7-14(2,11-16)10-15(3,8-13)12-16/h13H,4-12H2,1-3H3/t13?,14-,15+,16?,18? |
| InChIKey | MSUPYABPRFFYGA-DQFJYLTPSA-N |
| XLogP | 4.28 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.47 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |