C15H24OS2 — CID 135061438
(1S,2S)-2-(1-adamantylmethyl)-1,3-dithiane 1-oxide (PubChem CID 135061438) has the molecular formula C15H24OS2 and a molecular weight of 284.49 g/mol. Its IUPAC name is (1S,2S)-2-(1-adamantylmethyl)-1,3-dithiane 1-oxide.
| Compound Name | (1S,2S)-2-(1-adamantylmethyl)-1,3-dithiane 1-oxide |
|---|---|
| PubChem CID | 135061438 |
| Molecular Formula | C15H24OS2 |
| Molecular Weight | 284.49 g/mol |
| Exact Mass | 284.13 |
| IUPAC Name | (1S,2S)-2-(1-adamantylmethyl)-1,3-dithiane 1-oxide |
| SMILES | O=[S@]1CCCS[C@@H]1CC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C15H24OS2/c16-18-3-1-2-17-14(18)10-15-7-11-4-12(8-15)6-13(5-11)9-15/h11-14H,1-10H2/t11?,12?,13?,14-,15?,18-/m0/s1 |
| InChIKey | KHEDAVGLEBOIRP-IELOURAQSA-N |
| XLogP | 3.80 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.49 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |