C17H28S2 — CID 11208695
2-[2-(1-adamantyl)ethyl]-2-methyl-1,3-dithiane (PubChem CID 11208695) has the molecular formula C17H28S2 and a molecular weight of 296.54 g/mol. Its IUPAC name is 2-[2-(1-adamantyl)ethyl]-2-methyl-1,3-dithiane.
| Compound Name | 2-[2-(1-adamantyl)ethyl]-2-methyl-1,3-dithiane |
|---|---|
| PubChem CID | 11208695 |
| Molecular Formula | C17H28S2 |
| Molecular Weight | 296.54 g/mol |
| Exact Mass | 296.16 |
| IUPAC Name | 2-[2-(1-adamantyl)ethyl]-2-methyl-1,3-dithiane |
| SMILES | CC1(CCC23CC4CC(CC(C4)C2)C3)SCCCS1 |
| InChI | InChI=1S/C17H28S2/c1-16(18-5-2-6-19-16)3-4-17-10-13-7-14(11-17)9-15(8-13)12-17/h13-15H,2-12H2,1H3 |
| InChIKey | NXRLMBBVHTXQKK-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.54 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |