C16H28S2 — CID 91169752
1-ethyl-3-[2-(methylsulfanylmethylsulfanyl)ethyl]adamantane (PubChem CID 91169752) has the molecular formula C16H28S2 and a molecular weight of 284.53 g/mol. Its IUPAC name is 1-ethyl-3-[2-(methylsulfanylmethylsulfanyl)ethyl]adamantane.
| Compound Name | 1-ethyl-3-[2-(methylsulfanylmethylsulfanyl)ethyl]adamantane |
|---|---|
| PubChem CID | 91169752 |
| Molecular Formula | C16H28S2 |
| Molecular Weight | 284.53 g/mol |
| Exact Mass | 284.16 |
| IUPAC Name | 1-ethyl-3-[2-(methylsulfanylmethylsulfanyl)ethyl]adamantane |
| SMILES | CCC12CC3CC(C1)CC(CCSCSC)(C3)C2 |
| InChI | InChI=1S/C16H28S2/c1-3-15-7-13-6-14(8-15)10-16(9-13,11-15)4-5-18-12-17-2/h13-14H,3-12H2,1-2H3 |
| InChIKey | JBYIEZPFRIFOMI-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.53 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|