C13H22S — CID 123993452
1,3-dimethyl-5-methylsulfanyladamantane (PubChem CID 123993452) has the molecular formula C13H22S and a molecular weight of 210.39 g/mol. Its IUPAC name is 1,3-dimethyl-5-methylsulfanyladamantane.
| Compound Name | 1,3-dimethyl-5-methylsulfanyladamantane |
|---|---|
| PubChem CID | 123993452 |
| Molecular Formula | C13H22S |
| Molecular Weight | 210.39 g/mol |
| Exact Mass | 210.14 |
| IUPAC Name | 1,3-dimethyl-5-methylsulfanyladamantane |
| SMILES | CSC12CC3CC(C)(CC(C)(C3)C1)C2 |
| InChI | InChI=1S/C13H22S/c1-11-4-10-5-12(2,7-11)9-13(6-10,8-11)14-3/h10H,4-9H2,1-3H3 |
| InChIKey | JWNDDLIIILKWMY-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.39 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |