C14H22S2 — CID 11322792
2-(1-adamantyl)-1,3-dithiane (PubChem CID 11322792) has the molecular formula C14H22S2 and a molecular weight of 254.46 g/mol. Its IUPAC name is 2-(1-adamantyl)-1,3-dithiane.
| Compound Name | 2-(1-adamantyl)-1,3-dithiane |
|---|---|
| PubChem CID | 11322792 |
| Molecular Formula | C14H22S2 |
| Molecular Weight | 254.46 g/mol |
| Exact Mass | 254.12 |
| IUPAC Name | 2-(1-adamantyl)-1,3-dithiane |
| SMILES | C1CSC(C23CC4CC(CC(C4)C2)C3)SC1 |
| InChI | InChI=1S/C14H22S2/c1-2-15-13(16-3-1)14-7-10-4-11(8-14)6-12(5-10)9-14/h10-13H,1-9H2 |
| InChIKey | BNTARQANJXMSSL-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.46 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |