C14H22S — CID 162698427
spiro[adamantane-2,4'-thiane] (PubChem CID 162698427) has the molecular formula C14H22S and a molecular weight of 222.40 g/mol. Its IUPAC name is spiro[adamantane-2,4'-thiane].
| Compound Name | spiro[adamantane-2,4'-thiane] |
|---|---|
| PubChem CID | 162698427 |
| Molecular Formula | C14H22S |
| Molecular Weight | 222.40 g/mol |
| Exact Mass | 222.14 |
| IUPAC Name | spiro[adamantane-2,4'-thiane] |
| SMILES | C1CC2(CCS1)C1CC3CC(C1)CC2C3 |
| InChI | InChI=1S/C14H22S/c1-3-15-4-2-14(1)12-6-10-5-11(8-12)9-13(14)7-10/h10-13H,1-9H2 |
| InChIKey | RHIBORHGKXXALW-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.40 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |