C16H26S2 — CID 86217088
2-[2-(1-adamantyl)ethyl]-1,3-dithiane (PubChem CID 86217088) has the molecular formula C16H26S2 and a molecular weight of 282.52 g/mol. Its IUPAC name is 2-[2-(1-adamantyl)ethyl]-1,3-dithiane.
| Compound Name | 2-[2-(1-adamantyl)ethyl]-1,3-dithiane |
|---|---|
| PubChem CID | 86217088 |
| Molecular Formula | C16H26S2 |
| Molecular Weight | 282.52 g/mol |
| Exact Mass | 282.15 |
| IUPAC Name | 2-[2-(1-adamantyl)ethyl]-1,3-dithiane |
| SMILES | C1CSC(CCC23CC4CC(CC(C4)C2)C3)SC1 |
| InChI | InChI=1S/C16H26S2/c1-4-17-15(18-5-1)2-3-16-9-12-6-13(10-16)8-14(7-12)11-16/h12-15H,1-11H2 |
| InChIKey | FZMNXYJVJMTWSF-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.52 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |