C15H24S2 — CID 101265331
2-(1-adamantyl)-2-methyl-1,3-dithiane (PubChem CID 101265331) has the molecular formula C15H24S2 and a molecular weight of 268.49 g/mol. Its IUPAC name is 2-(1-adamantyl)-2-methyl-1,3-dithiane.
| Compound Name | 2-(1-adamantyl)-2-methyl-1,3-dithiane |
|---|---|
| PubChem CID | 101265331 |
| Molecular Formula | C15H24S2 |
| Molecular Weight | 268.49 g/mol |
| Exact Mass | 268.13 |
| IUPAC Name | 2-(1-adamantyl)-2-methyl-1,3-dithiane |
| SMILES | CC1(C23CC4CC(CC(C4)C2)C3)SCCCS1 |
| InChI | InChI=1S/C15H24S2/c1-14(16-3-2-4-17-14)15-8-11-5-12(9-15)7-13(6-11)10-15/h11-13H,2-10H2,1H3 |
| InChIKey | IZNJZFAKMJRJFD-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.49 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |