C25H29NOS — CID 134927892
(2R,3S)-1-benzylsulfanyl-3-(dibenzylamino)butan-2-ol (PubChem CID 134927892) has the molecular formula C25H29NOS and a molecular weight of 391.58 g/mol. Its IUPAC name is (2R,3S)-1-benzylsulfanyl-3-(dibenzylamino)butan-2-ol.
| Compound Name | (2R,3S)-1-benzylsulfanyl-3-(dibenzylamino)butan-2-ol |
|---|---|
| PubChem CID | 134927892 |
| Molecular Formula | C25H29NOS |
| Molecular Weight | 391.58 g/mol |
| Exact Mass | 391.20 |
| IUPAC Name | (2R,3S)-1-benzylsulfanyl-3-(dibenzylamino)butan-2-ol |
| SMILES | C[C@@H]([C@@H](O)CSCc1ccccc1)N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C25H29NOS/c1-21(25(27)20-28-19-24-15-9-4-10-16-24)26(17-22-11-5-2-6-12-22)18-23-13-7-3-8-14-23/h2-16,21,25,27H,17-20H2,1H3/t21-,25-/m0/s1 |
| InChIKey | AQJXHQSXSORJOL-OFVILXPXSA-N |
| XLogP | 5.37 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.58 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |