C20H17Se+ — CID 134928041
(2R,4S)-2,4-dimethyl-3-phenyl-3-selenoniatetracyclo[7.3.1.02,4.05,13]trideca-1(12),5,7,9(13),10-pentaene (PubChem CID 134928041) has the molecular formula C20H17Se+ and a molecular weight of 336.32 g/mol. Its IUPAC name is (2R,4S)-2,4-dimethyl-3-phenyl-3-selenoniatetracyclo[7.3.1.02,4.05,13]trideca-1(12),5,7,9(13),10-pentaene.
| Compound Name | (2R,4S)-2,4-dimethyl-3-phenyl-3-selenoniatetracyclo[7.3.1.02,4.05,13]trideca-1(12),5,7,9(13),10-pentaene |
|---|---|
| PubChem CID | 134928041 |
| Molecular Formula | C20H17Se+ |
| Molecular Weight | 336.32 g/mol |
| Exact Mass | 337.05 |
| IUPAC Name | (2R,4S)-2,4-dimethyl-3-phenyl-3-selenoniatetracyclo[7.3.1.02,4.05,13]trideca-1(12),5,7,9(13),10-pentaene |
| SMILES | C[C@@]12c3cccc4cccc(c34)[C@]1(C)[Se+]2c1ccccc1 |
| InChI | InChI=1S/C20H17Se/c1-19-16-12-6-8-14-9-7-13-17(18(14)16)20(19,2)21(19)15-10-4-3-5-11-15/h3-13H,1-2H3/q+1/t19-,20+,21? |
| InChIKey | ONQPFAWQYZXXQD-WCRBZPEASA-N |
| XLogP | 3.86 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.32 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|