C28H28Ge — CID 177264701
2,2,4,4-tetramethyl-3,3-diphenyl-3-germatricyclo[7.3.1.05,13]trideca-1(12),5,7,9(13),10-pentaene (PubChem CID 177264701) has the molecular formula C28H28Ge and a molecular weight of 437.14 g/mol. Its IUPAC name is 2,2,4,4-tetramethyl-3,3-diphenyl-3-germatricyclo[7.3.1.05,13]trideca-1(12),5,7,9(13),10-pentaene.
| Compound Name | 2,2,4,4-tetramethyl-3,3-diphenyl-3-germatricyclo[7.3.1.05,13]trideca-1(12),5,7,9(13),10-pentaene |
|---|---|
| PubChem CID | 177264701 |
| Molecular Formula | C28H28Ge |
| Molecular Weight | 437.14 g/mol |
| Exact Mass | 438.14 |
| IUPAC Name | 2,2,4,4-tetramethyl-3,3-diphenyl-3-germatricyclo[7.3.1.05,13]trideca-1(12),5,7,9(13),10-pentaene |
| SMILES | CC1(C)c2cccc3cccc(c23)C(C)(C)[Ge]1(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C28H28Ge/c1-27(2)24-19-11-13-21-14-12-20-25(26(21)24)28(3,4)29(27,22-15-7-5-8-16-22)23-17-9-6-10-18-23/h5-20H,1-4H3 |
| InChIKey | IZEMJRLYBYDKIJ-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.14 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |