C18H15BO2S — CID 166437344
(6bS,9aR)-6b,9a-dimethyl-8-thiophen-3-ylacenaphthyleno[1,2-d][1,3,2]dioxaborole (PubChem CID 166437344) has the molecular formula C18H15BO2S and a molecular weight of 306.20 g/mol. Its IUPAC name is (6bS,9aR)-6b,9a-dimethyl-8-thiophen-3-ylacenaphthyleno[1,2-d][1,3,2]dioxaborole.
| Compound Name | (6bS,9aR)-6b,9a-dimethyl-8-thiophen-3-ylacenaphthyleno[1,2-d][1,3,2]dioxaborole |
|---|---|
| PubChem CID | 166437344 |
| Molecular Formula | C18H15BO2S |
| Molecular Weight | 306.20 g/mol |
| Exact Mass | 306.09 |
| IUPAC Name | (6bS,9aR)-6b,9a-dimethyl-8-thiophen-3-ylacenaphthyleno[1,2-d][1,3,2]dioxaborole |
| SMILES | C[C@@]12OB(c3ccsc3)O[C@]1(C)c1cccc3cccc2c13 |
| InChI | InChI=1S/C18H15BO2S/c1-17-14-7-3-5-12-6-4-8-15(16(12)14)18(17,2)21-19(20-17)13-9-10-22-11-13/h3-11H,1-2H3/t17-,18+ |
| InChIKey | FCABMNKAFQIWRI-HDICACEKSA-N |
| XLogP | 3.79 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.20 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|