C14H18O3S — CID 134928182
1-[(3R,5S)-5-[(E)-3-phenylsulfanylprop-1-enyl]dioxolan-3-yl]ethanol (PubChem CID 134928182) has the molecular formula C14H18O3S and a molecular weight of 266.36 g/mol. Its IUPAC name is 1-[(3R,5S)-5-[(E)-3-phenylsulfanylprop-1-enyl]dioxolan-3-yl]ethanol.
| Compound Name | 1-[(3R,5S)-5-[(E)-3-phenylsulfanylprop-1-enyl]dioxolan-3-yl]ethanol |
|---|---|
| PubChem CID | 134928182 |
| Molecular Formula | C14H18O3S |
| Molecular Weight | 266.36 g/mol |
| Exact Mass | 266.10 |
| IUPAC Name | 1-[(3R,5S)-5-[(E)-3-phenylsulfanylprop-1-enyl]dioxolan-3-yl]ethanol |
| SMILES | CC(O)[C@H]1C[C@@H](/C=C/CSc2ccccc2)OO1 |
| InChI | InChI=1S/C14H18O3S/c1-11(15)14-10-12(16-17-14)6-5-9-18-13-7-3-2-4-8-13/h2-8,11-12,14-15H,9-10H2,1H3/b6-5+/t11?,12-,14-/m1/s1 |
| InChIKey | QSYKGNSMSOSKAZ-DFIRHEJRSA-N |
| XLogP | 2.80 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.36 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|