C17H30O3 — CID 134928348
ethyl (2S,5S)-5-butyl-5-hexyl-2H-furan-2-carboxylate (PubChem CID 134928348) has the molecular formula C17H30O3 and a molecular weight of 282.42 g/mol. Its IUPAC name is ethyl (2S,5S)-5-butyl-5-hexyl-2H-furan-2-carboxylate.
| Compound Name | ethyl (2S,5S)-5-butyl-5-hexyl-2H-furan-2-carboxylate |
|---|---|
| PubChem CID | 134928348 |
| Molecular Formula | C17H30O3 |
| Molecular Weight | 282.42 g/mol |
| Exact Mass | 282.22 |
| IUPAC Name | ethyl (2S,5S)-5-butyl-5-hexyl-2H-furan-2-carboxylate |
| SMILES | CCCCCC[C@@]1(CCCC)C=C[C@@H](C(=O)OCC)O1 |
| InChI | InChI=1S/C17H30O3/c1-4-7-9-10-13-17(12-8-5-2)14-11-15(20-17)16(18)19-6-3/h11,14-15H,4-10,12-13H2,1-3H3/t15-,17-/m0/s1 |
| InChIKey | QKOVQRRUGRZEID-RDJZCZTQSA-N |
| XLogP | 4.40 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.42 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|