C18H32O3 — CID 101083206
ethyl (2S,5S)-5-tert-butyl-5-hexyl-2-methylfuran-2-carboxylate (PubChem CID 101083206) has the molecular formula C18H32O3 and a molecular weight of 296.45 g/mol. Its IUPAC name is ethyl (2S,5S)-5-tert-butyl-5-hexyl-2-methylfuran-2-carboxylate.
| Compound Name | ethyl (2S,5S)-5-tert-butyl-5-hexyl-2-methylfuran-2-carboxylate |
|---|---|
| PubChem CID | 101083206 |
| Molecular Formula | C18H32O3 |
| Molecular Weight | 296.45 g/mol |
| Exact Mass | 296.24 |
| IUPAC Name | ethyl (2S,5S)-5-tert-butyl-5-hexyl-2-methylfuran-2-carboxylate |
| SMILES | CCCCCC[C@@]1(C(C)(C)C)C=C[C@@](C)(C(=O)OCC)O1 |
| InChI | InChI=1S/C18H32O3/c1-7-9-10-11-12-18(16(3,4)5)14-13-17(6,21-18)15(19)20-8-2/h13-14H,7-12H2,1-6H3/t17-,18-/m0/s1 |
| InChIKey | HCYWMEDQBGSZSC-ROUUACIJSA-N |
| XLogP | 4.65 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.45 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|