C28H50O3 — CID 123904810
2-cyclohexylpropan-2-yl 2-[5-(2,2,5,5-tetramethylhexan-3-yl)cyclohept-2-en-1-yl]oxyacetate (PubChem CID 123904810) has the molecular formula C28H50O3 and a molecular weight of 434.71 g/mol. Its IUPAC name is 2-cyclohexylpropan-2-yl 2-[5-(2,2,5,5-tetramethylhexan-3-yl)cyclohept-2-en-1-yl]oxyacetate.
| Compound Name | 2-cyclohexylpropan-2-yl 2-[5-(2,2,5,5-tetramethylhexan-3-yl)cyclohept-2-en-1-yl]oxyacetate |
|---|---|
| PubChem CID | 123904810 |
| Molecular Formula | C28H50O3 |
| Molecular Weight | 434.71 g/mol |
| Exact Mass | 434.38 |
| IUPAC Name | 2-cyclohexylpropan-2-yl 2-[5-(2,2,5,5-tetramethylhexan-3-yl)cyclohept-2-en-1-yl]oxyacetate |
| SMILES | CC(C)(C)CC(C1CC=CC(OCC(=O)OC(C)(C)C2CCCCC2)CC1)C(C)(C)C |
| InChI | InChI=1S/C28H50O3/c1-26(2,3)19-24(27(4,5)6)21-13-12-16-23(18-17-21)30-20-25(29)31-28(7,8)22-14-10-9-11-15-22/h12,16,21-24H,9-11,13-15,17-20H2,1-8H3 |
| InChIKey | YWWBWNVRSVSAJZ-UHFFFAOYSA-N |
| XLogP | 7.73 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.71 |
| LogP ≤ 5 | 7.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|