C30H50O4 — CID 59870939
tert-butyl 2-[(2E)-2-[(2S)-2-[(1E,3E,5R,8S)-5-hydroxy-8,12-dimethyltrideca-1,3,11-trienyl]-2-methylcyclohexylidene]ethoxy]acetate (PubChem CID 59870939) has the molecular formula C30H50O4 and a molecular weight of 474.73 g/mol. Its IUPAC name is tert-butyl 2-[(2E)-2-[(2S)-2-[(1E,3E,5R,8S)-5-hydroxy-8,12-dimethyltrideca-1,3,11-trienyl]-2-methylcyclohexylidene]ethoxy]acetate.
| Compound Name | tert-butyl 2-[(2E)-2-[(2S)-2-[(1E,3E,5R,8S)-5-hydroxy-8,12-dimethyltrideca-1,3,11-trienyl]-2-methylcyclohexylidene]ethoxy]acetate |
|---|---|
| PubChem CID | 59870939 |
| Molecular Formula | C30H50O4 |
| Molecular Weight | 474.73 g/mol |
| Exact Mass | 474.37 |
| IUPAC Name | tert-butyl 2-[(2E)-2-[(2S)-2-[(1E,3E,5R,8S)-5-hydroxy-8,12-dimethyltrideca-1,3,11-trienyl]-2-methylcyclohexylidene]ethoxy]acetate |
| SMILES | CC(C)=CCC[C@H](C)CC[C@@H](O)/C=C/C=C/[C@]1(C)CCCC/C1=C\COCC(=O)OC(C)(C)C |
| InChI | InChI=1S/C30H50O4/c1-24(2)13-12-14-25(3)17-18-27(31)16-9-11-21-30(7)20-10-8-15-26(30)19-22-33-23-28(32)34-29(4,5)6/h9,11,13,16,19,21,25,27,31H,8,10,12,14-15,17-18,20,22-23H2,1-7H3/b16-9+,21-11+,26-19+/t25-,27-,30-/m0/s1 |
| InChIKey | BZSGVWUELZJRMJ-MNARCQCWSA-N |
| XLogP | 7.49 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.73 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|