C32H52O3 — CID 134722462
[(1R,2E,6E,10E,14S)-3,7,11-trimethyl-14-prop-1-en-2-ylcyclotetradeca-2,6,10-trien-1-yl] 2-[(2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxyacetate (PubChem CID 134722462) has the molecular formula C32H52O3 and a molecular weight of 484.77 g/mol. Its IUPAC name is [(1R,2E,6E,10E,14S)-3,7,11-trimethyl-14-prop-1-en-2-ylcyclotetradeca-2,6,10-trien-1-yl] 2-[(2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxyacetate.
| Compound Name | [(1R,2E,6E,10E,14S)-3,7,11-trimethyl-14-prop-1-en-2-ylcyclotetradeca-2,6,10-trien-1-yl] 2-[(2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxyacetate |
|---|---|
| PubChem CID | 134722462 |
| Molecular Formula | C32H52O3 |
| Molecular Weight | 484.77 g/mol |
| Exact Mass | 484.39 |
| IUPAC Name | [(1R,2E,6E,10E,14S)-3,7,11-trimethyl-14-prop-1-en-2-ylcyclotetradeca-2,6,10-trien-1-yl] 2-[(2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxyacetate |
| SMILES | C=C(C)[C@@H]1CC/C(C)=C/CC/C(C)=C/CC/C(C)=C/[C@H]1OC(=O)COC1C[C@H](C)CC[C@H]1C(C)C |
| InChI | InChI=1S/C32H52O3/c1-22(2)28-18-16-27(8)19-30(28)34-21-32(33)35-31-20-26(7)14-10-12-24(5)11-9-13-25(6)15-17-29(31)23(3)4/h12-13,20,22,27-31H,3,9-11,14-19,21H2,1-2,4-8H3/b24-12+,25-13+,26-20+/t27-,28+,29+,30?,31-/m1/s1 |
| InChIKey | BUSOZEVHMMWLRH-XURRZXJESA-N |
| XLogP | 8.76 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.77 |
| LogP ≤ 5 | 8.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|