C29H50O3 — CID 123227819
2-cyclopentylpropan-2-yl 2-[4-(3,3,6,6-tetramethyloctan-4-yl)cyclohepta-2,6-dien-1-yl]oxyacetate (PubChem CID 123227819) has the molecular formula C29H50O3 and a molecular weight of 446.72 g/mol. Its IUPAC name is 2-cyclopentylpropan-2-yl 2-[4-(3,3,6,6-tetramethyloctan-4-yl)cyclohepta-2,6-dien-1-yl]oxyacetate.
| Compound Name | 2-cyclopentylpropan-2-yl 2-[4-(3,3,6,6-tetramethyloctan-4-yl)cyclohepta-2,6-dien-1-yl]oxyacetate |
|---|---|
| PubChem CID | 123227819 |
| Molecular Formula | C29H50O3 |
| Molecular Weight | 446.72 g/mol |
| Exact Mass | 446.38 |
| IUPAC Name | 2-cyclopentylpropan-2-yl 2-[4-(3,3,6,6-tetramethyloctan-4-yl)cyclohepta-2,6-dien-1-yl]oxyacetate |
| SMILES | CCC(C)(C)CC(C1C=CC(OCC(=O)OC(C)(C)C2CCCC2)C=CC1)C(C)(C)CC |
| InChI | InChI=1S/C29H50O3/c1-9-27(3,4)20-25(28(5,6)10-2)22-14-13-17-24(19-18-22)31-21-26(30)32-29(7,8)23-15-11-12-16-23/h13,17-19,22-25H,9-12,14-16,20-21H2,1-8H3 |
| InChIKey | QILVNDVBDLGPSS-UHFFFAOYSA-N |
| XLogP | 7.89 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.72 |
| LogP ≤ 5 | 7.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|