C30H46O3 — CID 123621881
1-cyclohepta-1,4,6-trien-1-ylethyl 2-[1-methyl-4-(3,3,6,6-tetramethyloctan-4-yl)cyclohexa-2,4-dien-1-yl]oxyacetate (PubChem CID 123621881) has the molecular formula C30H46O3 and a molecular weight of 454.70 g/mol. Its IUPAC name is 1-cyclohepta-1,4,6-trien-1-ylethyl 2-[1-methyl-4-(3,3,6,6-tetramethyloctan-4-yl)cyclohexa-2,4-dien-1-yl]oxyacetate.
| Compound Name | 1-cyclohepta-1,4,6-trien-1-ylethyl 2-[1-methyl-4-(3,3,6,6-tetramethyloctan-4-yl)cyclohexa-2,4-dien-1-yl]oxyacetate |
|---|---|
| PubChem CID | 123621881 |
| Molecular Formula | C30H46O3 |
| Molecular Weight | 454.70 g/mol |
| Exact Mass | 454.34 |
| IUPAC Name | 1-cyclohepta-1,4,6-trien-1-ylethyl 2-[1-methyl-4-(3,3,6,6-tetramethyloctan-4-yl)cyclohexa-2,4-dien-1-yl]oxyacetate |
| SMILES | CCC(C)(C)CC(C1=CCC(C)(OCC(=O)OC(C)C2=CCC=CC=C2)C=C1)C(C)(C)CC |
| InChI | InChI=1S/C30H46O3/c1-9-28(4,5)21-26(29(6,7)10-2)25-17-19-30(8,20-18-25)32-22-27(31)33-23(3)24-15-13-11-12-14-16-24/h11-13,15-19,23,26H,9-10,14,20-22H2,1-8H3 |
| InChIKey | HLAUMNILPGEDHP-UHFFFAOYSA-N |
| XLogP | 7.90 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.70 |
| LogP ≤ 5 | 7.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |