C31H56O3 — CID 123374111
2-cyclohexylpropan-2-yl 2-[11,11-dimethyl-9-(2-methylbutan-2-yl)trideca-4,6-dien-6-yl]oxyacetate (PubChem CID 123374111) has the molecular formula C31H56O3 and a molecular weight of 476.79 g/mol. Its IUPAC name is 2-cyclohexylpropan-2-yl 2-[11,11-dimethyl-9-(2-methylbutan-2-yl)trideca-4,6-dien-6-yl]oxyacetate.
| Compound Name | 2-cyclohexylpropan-2-yl 2-[11,11-dimethyl-9-(2-methylbutan-2-yl)trideca-4,6-dien-6-yl]oxyacetate |
|---|---|
| PubChem CID | 123374111 |
| Molecular Formula | C31H56O3 |
| Molecular Weight | 476.79 g/mol |
| Exact Mass | 476.42 |
| IUPAC Name | 2-cyclohexylpropan-2-yl 2-[11,11-dimethyl-9-(2-methylbutan-2-yl)trideca-4,6-dien-6-yl]oxyacetate |
| SMILES | CCCC=CC(=CCC(CC(C)(C)CC)C(C)(C)CC)OCC(=O)OC(C)(C)C1CCCCC1 |
| InChI | InChI=1S/C31H56O3/c1-10-13-15-20-27(22-21-26(30(6,7)12-3)23-29(4,5)11-2)33-24-28(32)34-31(8,9)25-18-16-14-17-19-25/h15,20,22,25-26H,10-14,16-19,21,23-24H2,1-9H3 |
| InChIKey | ALJRZKYMLSBZRR-UHFFFAOYSA-N |
| XLogP | 9.41 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.79 |
| LogP ≤ 5 | 9.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|