C19H20O5 — CID 134928670
1-(3-hydroxy-3-methoxy-6,6-diphenyldioxan-4-yl)ethanone (PubChem CID 134928670) has the molecular formula C19H20O5 and a molecular weight of 328.36 g/mol. Its IUPAC name is 1-(3-hydroxy-3-methoxy-6,6-diphenyldioxan-4-yl)ethanone.
| Compound Name | 1-(3-hydroxy-3-methoxy-6,6-diphenyldioxan-4-yl)ethanone |
|---|---|
| PubChem CID | 134928670 |
| Molecular Formula | C19H20O5 |
| Molecular Weight | 328.36 g/mol |
| Exact Mass | 328.13 |
| IUPAC Name | 1-(3-hydroxy-3-methoxy-6,6-diphenyldioxan-4-yl)ethanone |
| SMILES | COC1(O)OOC(c2ccccc2)(c2ccccc2)CC1C(C)=O |
| InChI | InChI=1S/C19H20O5/c1-14(20)17-13-18(15-9-5-3-6-10-15,16-11-7-4-8-12-16)23-24-19(17,21)22-2/h3-12,17,21H,13H2,1-2H3 |
| InChIKey | ULXZVHZBVPRWPQ-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.36 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|