C14H17NO2S2 — CID 134929233
3-acetyl-2-benzylsulfanylthiolane-2-carboxamide (PubChem CID 134929233) has the molecular formula C14H17NO2S2 and a molecular weight of 295.43 g/mol. Its IUPAC name is 3-acetyl-2-benzylsulfanylthiolane-2-carboxamide.
| Compound Name | 3-acetyl-2-benzylsulfanylthiolane-2-carboxamide |
|---|---|
| PubChem CID | 134929233 |
| Molecular Formula | C14H17NO2S2 |
| Molecular Weight | 295.43 g/mol |
| Exact Mass | 295.07 |
| IUPAC Name | 3-acetyl-2-benzylsulfanylthiolane-2-carboxamide |
| SMILES | CC(=O)C1CCSC1(SCc1ccccc1)C(N)=O |
| InChI | InChI=1S/C14H17NO2S2/c1-10(16)12-7-8-18-14(12,13(15)17)19-9-11-5-3-2-4-6-11/h2-6,12H,7-9H2,1H3,(H2,15,17) |
| InChIKey | AZHCKTVZXLDULG-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.43 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |