C14H30O6P2 — CID 134929353
1,1-bis(diethoxyphosphoryl)-2,3-dimethylbut-2-ene (PubChem CID 134929353) has the molecular formula C14H30O6P2 and a molecular weight of 356.34 g/mol. Its IUPAC name is 1,1-bis(diethoxyphosphoryl)-2,3-dimethylbut-2-ene.
| Compound Name | 1,1-bis(diethoxyphosphoryl)-2,3-dimethylbut-2-ene |
|---|---|
| PubChem CID | 134929353 |
| Molecular Formula | C14H30O6P2 |
| Molecular Weight | 356.34 g/mol |
| Exact Mass | 356.15 |
| IUPAC Name | 1,1-bis(diethoxyphosphoryl)-2,3-dimethylbut-2-ene |
| SMILES | CCOP(=O)(OCC)C(C(C)=C(C)C)P(=O)(OCC)OCC |
| InChI | InChI=1S/C14H30O6P2/c1-8-17-21(15,18-9-2)14(13(7)12(5)6)22(16,19-10-3)20-11-4/h14H,8-11H2,1-7H3 |
| InChIKey | OORVUWJVHVKBIB-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.34 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|