C28H36O4S2 — CID 134929927
methyl 7-[(2R)-2-[(4-methylphenyl)sulfanyl-[(R)-(4-methylphenyl)sulfinyl]methyl]-5-oxocyclopentyl]heptanoate (PubChem CID 134929927) has the molecular formula C28H36O4S2 and a molecular weight of 500.73 g/mol. Its IUPAC name is methyl 7-[(2R)-2-[(4-methylphenyl)sulfanyl-[(R)-(4-methylphenyl)sulfinyl]methyl]-5-oxocyclopentyl]heptanoate.
| Compound Name | methyl 7-[(2R)-2-[(4-methylphenyl)sulfanyl-[(R)-(4-methylphenyl)sulfinyl]methyl]-5-oxocyclopentyl]heptanoate |
|---|---|
| PubChem CID | 134929927 |
| Molecular Formula | C28H36O4S2 |
| Molecular Weight | 500.73 g/mol |
| Exact Mass | 500.21 |
| IUPAC Name | methyl 7-[(2R)-2-[(4-methylphenyl)sulfanyl-[(R)-(4-methylphenyl)sulfinyl]methyl]-5-oxocyclopentyl]heptanoate |
| SMILES | COC(=O)CCCCCCC1C(=O)CC[C@H]1C(Sc1ccc(C)cc1)[S@](=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C28H36O4S2/c1-20-10-14-22(15-11-20)33-28(34(31)23-16-12-21(2)13-17-23)25-18-19-26(29)24(25)8-6-4-5-7-9-27(30)32-3/h10-17,24-25,28H,4-9,18-19H2,1-3H3/t24?,25-,28?,34-/m1/s1 |
| InChIKey | IBABPNUWOZCWSF-GNQUTXEWSA-N |
| XLogP | 6.64 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.73 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|