C12H14F3O5PS — CID 134930136
[dimethoxyphosphoryl-(4-methylphenyl)sulfanylmethyl] 2,2,2-trifluoroacetate (PubChem CID 134930136) has the molecular formula C12H14F3O5PS and a molecular weight of 358.27 g/mol. Its IUPAC name is [dimethoxyphosphoryl-(4-methylphenyl)sulfanylmethyl] 2,2,2-trifluoroacetate.
| Compound Name | [dimethoxyphosphoryl-(4-methylphenyl)sulfanylmethyl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 134930136 |
| Molecular Formula | C12H14F3O5PS |
| Molecular Weight | 358.27 g/mol |
| Exact Mass | 358.03 |
| IUPAC Name | [dimethoxyphosphoryl-(4-methylphenyl)sulfanylmethyl] 2,2,2-trifluoroacetate |
| SMILES | COP(=O)(OC)C(OC(=O)C(F)(F)F)Sc1ccc(C)cc1 |
| InChI | InChI=1S/C12H14F3O5PS/c1-8-4-6-9(7-5-8)22-11(21(17,18-2)19-3)20-10(16)12(13,14)15/h4-7,11H,1-3H3 |
| InChIKey | XIQKQEWBPHDKFX-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.27 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|