C34H36O7S — CID 134930472
[(1R)-1-[(2S,3R,4S)-3,4-bis(phenylmethoxy)oxolan-2-yl]-2-phenylmethoxyethyl] 4-methylbenzenesulfonate (PubChem CID 134930472) has the molecular formula C34H36O7S and a molecular weight of 588.72 g/mol. Its IUPAC name is [(1R)-1-[(2S,3R,4S)-3,4-bis(phenylmethoxy)oxolan-2-yl]-2-phenylmethoxyethyl] 4-methylbenzenesulfonate.
| Compound Name | [(1R)-1-[(2S,3R,4S)-3,4-bis(phenylmethoxy)oxolan-2-yl]-2-phenylmethoxyethyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 134930472 |
| Molecular Formula | C34H36O7S |
| Molecular Weight | 588.72 g/mol |
| Exact Mass | 588.22 |
| IUPAC Name | [(1R)-1-[(2S,3R,4S)-3,4-bis(phenylmethoxy)oxolan-2-yl]-2-phenylmethoxyethyl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)O[C@H](COCc2ccccc2)[C@H]2OC[C@H](OCc3ccccc3)[C@H]2OCc2ccccc2)cc1 |
| InChI | InChI=1S/C34H36O7S/c1-26-17-19-30(20-18-26)42(35,36)41-32(24-37-21-27-11-5-2-6-12-27)34-33(39-23-29-15-9-4-10-16-29)31(25-40-34)38-22-28-13-7-3-8-14-28/h2-20,31-34H,21-25H2,1H3/t31-,32+,33+,34+/m0/s1 |
| InChIKey | YTHPQADERLYLJQ-KRFMAMIKSA-N |
| XLogP | 5.86 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.72 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|