C10H20O3 — CID 134930503
(3R,4S)-4-(ethoxymethoxy)-3-methylhex-5-en-3-ol (PubChem CID 134930503) has the molecular formula C10H20O3 and a molecular weight of 188.27 g/mol. Its IUPAC name is (3R,4S)-4-(ethoxymethoxy)-3-methylhex-5-en-3-ol.
| Compound Name | (3R,4S)-4-(ethoxymethoxy)-3-methylhex-5-en-3-ol |
|---|---|
| PubChem CID | 134930503 |
| Molecular Formula | C10H20O3 |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.14 |
| IUPAC Name | (3R,4S)-4-(ethoxymethoxy)-3-methylhex-5-en-3-ol |
| SMILES | C=C[C@H](OCOCC)[C@](C)(O)CC |
| InChI | InChI=1S/C10H20O3/c1-5-9(10(4,11)6-2)13-8-12-7-3/h5,9,11H,1,6-8H2,2-4H3/t9-,10+/m0/s1 |
| InChIKey | IMQFMOBVYIAEIZ-VHSXEESVSA-N |
| XLogP | 1.71 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|