C15H22O4 — CID 134930643
[(3aS,5R,7aR)-6-hydroxy-1-oxo-5-prop-1-en-2-yl-2,3,3a,4,5,6,7,7a-octahydroinden-4-yl]methyl acetate (PubChem CID 134930643) has the molecular formula C15H22O4 and a molecular weight of 266.34 g/mol. Its IUPAC name is [(3aS,5R,7aR)-6-hydroxy-1-oxo-5-prop-1-en-2-yl-2,3,3a,4,5,6,7,7a-octahydroinden-4-yl]methyl acetate.
| Compound Name | [(3aS,5R,7aR)-6-hydroxy-1-oxo-5-prop-1-en-2-yl-2,3,3a,4,5,6,7,7a-octahydroinden-4-yl]methyl acetate |
|---|---|
| PubChem CID | 134930643 |
| Molecular Formula | C15H22O4 |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.15 |
| IUPAC Name | [(3aS,5R,7aR)-6-hydroxy-1-oxo-5-prop-1-en-2-yl-2,3,3a,4,5,6,7,7a-octahydroinden-4-yl]methyl acetate |
| SMILES | C=C(C)[C@@H]1C(O)C[C@H]2C(=O)CC[C@H]2C1COC(C)=O |
| InChI | InChI=1S/C15H22O4/c1-8(2)15-12(7-19-9(3)16)10-4-5-13(17)11(10)6-14(15)18/h10-12,14-15,18H,1,4-7H2,2-3H3/t10-,11-,12?,14?,15+/m1/s1 |
| InChIKey | FHKMYWAVOMOSFD-OUGLNLFMSA-N |
| XLogP | 1.72 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|