C15H23N3O2 — CID 166809490
[(4R,5R,6S)-12-propan-2-yl-10,11,12-triazatricyclo[7.3.0.04,6]dodeca-1(9),10-dien-5-yl]methyl acetate (PubChem CID 166809490) has the molecular formula C15H23N3O2 and a molecular weight of 277.37 g/mol. Its IUPAC name is [(4R,5R,6S)-12-propan-2-yl-10,11,12-triazatricyclo[7.3.0.04,6]dodeca-1(9),10-dien-5-yl]methyl acetate.
| Compound Name | [(4R,5R,6S)-12-propan-2-yl-10,11,12-triazatricyclo[7.3.0.04,6]dodeca-1(9),10-dien-5-yl]methyl acetate |
|---|---|
| PubChem CID | 166809490 |
| Molecular Formula | C15H23N3O2 |
| Molecular Weight | 277.37 g/mol |
| Exact Mass | 277.18 |
| IUPAC Name | [(4R,5R,6S)-12-propan-2-yl-10,11,12-triazatricyclo[7.3.0.04,6]dodeca-1(9),10-dien-5-yl]methyl acetate |
| SMILES | CC(=O)OC[C@@H]1[C@@H]2CCc3c(nnn3C(C)C)CC[C@@H]21 |
| InChI | InChI=1S/C15H23N3O2/c1-9(2)18-15-7-5-12-11(4-6-14(15)16-17-18)13(12)8-20-10(3)19/h9,11-13H,4-8H2,1-3H3/t11-,12+,13-/m0/s1 |
| InChIKey | HCKRHDFIAKLGPY-XQQFMLRXSA-N |
| XLogP | 2.16 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.37 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |