C18H29N3O2 — CID 161490127
[(4R,5R,6S)-12-propan-2-yl-10,11,12-triazatricyclo[7.3.0.04,6]dodeca-1(9),10-dien-5-yl]methyl 3-methylbutanoate (PubChem CID 161490127) has the molecular formula C18H29N3O2 and a molecular weight of 319.45 g/mol. Its IUPAC name is [(4R,5R,6S)-12-propan-2-yl-10,11,12-triazatricyclo[7.3.0.04,6]dodeca-1(9),10-dien-5-yl]methyl 3-methylbutanoate.
| Compound Name | [(4R,5R,6S)-12-propan-2-yl-10,11,12-triazatricyclo[7.3.0.04,6]dodeca-1(9),10-dien-5-yl]methyl 3-methylbutanoate |
|---|---|
| PubChem CID | 161490127 |
| Molecular Formula | C18H29N3O2 |
| Molecular Weight | 319.45 g/mol |
| Exact Mass | 319.23 |
| IUPAC Name | [(4R,5R,6S)-12-propan-2-yl-10,11,12-triazatricyclo[7.3.0.04,6]dodeca-1(9),10-dien-5-yl]methyl 3-methylbutanoate |
| SMILES | CC(C)CC(=O)OC[C@@H]1[C@@H]2CCc3c(nnn3C(C)C)CC[C@@H]21 |
| InChI | InChI=1S/C18H29N3O2/c1-11(2)9-18(22)23-10-15-13-5-7-16-17(8-6-14(13)15)21(12(3)4)20-19-16/h11-15H,5-10H2,1-4H3/t13-,14+,15-/m0/s1 |
| InChIKey | RPSSMIMKMAVLLL-ZNMIVQPWSA-N |
| XLogP | 3.19 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.45 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |