C12H18IN3 — CID 167034960
(4S,6R)-5-iodo-12-propan-2-yl-10,11,12-triazatricyclo[7.3.0.04,6]dodeca-1(9),10-diene (PubChem CID 167034960) has the molecular formula C12H18IN3 and a molecular weight of 331.20 g/mol. Its IUPAC name is (4S,6R)-5-iodo-12-propan-2-yl-10,11,12-triazatricyclo[7.3.0.04,6]dodeca-1(9),10-diene.
| Compound Name | (4S,6R)-5-iodo-12-propan-2-yl-10,11,12-triazatricyclo[7.3.0.04,6]dodeca-1(9),10-diene |
|---|---|
| PubChem CID | 167034960 |
| Molecular Formula | C12H18IN3 |
| Molecular Weight | 331.20 g/mol |
| Exact Mass | 331.05 |
| IUPAC Name | (4S,6R)-5-iodo-12-propan-2-yl-10,11,12-triazatricyclo[7.3.0.04,6]dodeca-1(9),10-diene |
| SMILES | CC(C)n1nnc2c1CC[C@@H]1C(I)[C@@H]1CC2 |
| InChI | InChI=1S/C12H18IN3/c1-7(2)16-11-6-4-9-8(12(9)13)3-5-10(11)14-15-16/h7-9,12H,3-6H2,1-2H3/t8-,9+,12?/m1/s1 |
| InChIKey | CSHCTXDGDJHSNG-RLBMWQAVSA-N |
| XLogP | 2.79 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.20 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|