About 5-ethyl-1-propan-2-yl-6,7-dihydro-4H-triazolo[4,5-c]pyridine
5-ethyl-1-propan-2-yl-6,7-dihydro-4H-triazolo[4,5-c]pyridine (PubChem CID 176984560) has the molecular formula C10H18N4
and a molecular weight of 194.28 g/mol. Its IUPAC name is 5-ethyl-1-propan-2-yl-6,7-dihydro-4H-triazolo[4,5-c]pyridine.
Molecular Properties
| Compound Name | 5-ethyl-1-propan-2-yl-6,7-dihydro-4H-triazolo[4,5-c]pyridine |
| PubChem CID | 176984560 |
| Molecular Formula | C10H18N4 |
| Molecular Weight | 194.28 g/mol |
| Exact Mass | 194.15 |
| IUPAC Name | 5-ethyl-1-propan-2-yl-6,7-dihydro-4H-triazolo[4,5-c]pyridine |
| SMILES | CCN1CCc2c(nnn2C(C)C)C1 |
| InChI | InChI=1S/C10H18N4/c1-4-13-6-5-10-9(7-13)11-12-14(10)8(2)3/h8H,4-7H2,1-3H3 |
| InChIKey | QVQNGFUIFKUQMY-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 33.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.28 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-ethyl-1-propan-2-yl-6,7-dihydro-4H-triazolo[4,5-c]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethyl-1-propan-2-yl-6,7-dihydro-4H-triazolo[4,5-c]pyridine?
The IUPAC name of 5-ethyl-1-propan-2-yl-6,7-dihydro-4H-triazolo[4,5-c]pyridine (CID 176984560) is 5-ethyl-1-propan-2-yl-6,7-dihydro-4H-triazolo[4,5-c]pyridine.
What is the SMILES notation for 5-ethyl-1-propan-2-yl-6,7-dihydro-4H-triazolo[4,5-c]pyridine?
The canonical SMILES for 5-ethyl-1-propan-2-yl-6,7-dihydro-4H-triazolo[4,5-c]pyridine is CCN1CCc2c(nnn2C(C)C)C1.
What is the InChIKey of 5-ethyl-1-propan-2-yl-6,7-dihydro-4H-triazolo[4,5-c]pyridine?
The InChIKey is QVQNGFUIFKUQMY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18N4/c1-4-13-6-5-10-9(7-13)11-12-14(10)8(2)3/h8H,4-7H2,1-3H3.
What are the key properties of 5-ethyl-1-propan-2-yl-6,7-dihydro-4H-triazolo[4,5-c]pyridine?
5-ethyl-1-propan-2-yl-6,7-dihydro-4H-triazolo[4,5-c]pyridine has a molecular weight of 194.28 g/mol, XLogP of 1.24, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethyl-1-propan-2-yl-6,7-dihydro-4H-triazolo[4,5-c]pyridine is sourced from PubChem (CID 176984560), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).