C16H25N3O2 — CID 166809514
[(4R,5R,6S)-12-methyl-10,11,12-triazatricyclo[7.3.0.04,6]dodeca-1(9),10-dien-5-yl]methyl 2-methylbutanoate (PubChem CID 166809514) has the molecular formula C16H25N3O2 and a molecular weight of 291.39 g/mol. Its IUPAC name is [(4R,5R,6S)-12-methyl-10,11,12-triazatricyclo[7.3.0.04,6]dodeca-1(9),10-dien-5-yl]methyl 2-methylbutanoate.
| Compound Name | [(4R,5R,6S)-12-methyl-10,11,12-triazatricyclo[7.3.0.04,6]dodeca-1(9),10-dien-5-yl]methyl 2-methylbutanoate |
|---|---|
| PubChem CID | 166809514 |
| Molecular Formula | C16H25N3O2 |
| Molecular Weight | 291.39 g/mol |
| Exact Mass | 291.19 |
| IUPAC Name | [(4R,5R,6S)-12-methyl-10,11,12-triazatricyclo[7.3.0.04,6]dodeca-1(9),10-dien-5-yl]methyl 2-methylbutanoate |
| SMILES | CCC(C)C(=O)OC[C@@H]1[C@@H]2CCc3c(nnn3C)CC[C@@H]21 |
| InChI | InChI=1S/C16H25N3O2/c1-4-10(2)16(20)21-9-13-11-5-7-14-15(8-6-12(11)13)19(3)18-17-14/h10-13H,4-9H2,1-3H3/t10?,11-,12+,13-/m0/s1 |
| InChIKey | DVTKURYBJGACSC-WVMKXHBISA-N |
| XLogP | 2.15 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.39 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |