C13H24O5 — CID 134930757
1-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-diethoxybut-3-en-1-ol (PubChem CID 134930757) has the molecular formula C13H24O5 and a molecular weight of 260.33 g/mol. Its IUPAC name is 1-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-diethoxybut-3-en-1-ol.
| Compound Name | 1-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-diethoxybut-3-en-1-ol |
|---|---|
| PubChem CID | 134930757 |
| Molecular Formula | C13H24O5 |
| Molecular Weight | 260.33 g/mol |
| Exact Mass | 260.16 |
| IUPAC Name | 1-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-diethoxybut-3-en-1-ol |
| SMILES | C=CC(OCC)(OCC)C(O)[C@H]1COC(C)(C)O1 |
| InChI | InChI=1S/C13H24O5/c1-6-13(15-7-2,16-8-3)11(14)10-9-17-12(4,5)18-10/h6,10-11,14H,1,7-9H2,2-5H3/t10-,11?/m1/s1 |
| InChIKey | JRIXUOHVFHYTTD-NFJWQWPMSA-N |
| XLogP | 1.45 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.33 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|