C12H22O4S — CID 134931699
methyl (2R)-2-[(2S)-1-ethylsulfanyl-1-oxopropan-2-yl]-2-hydroxy-4-methylpentanoate (PubChem CID 134931699) has the molecular formula C12H22O4S and a molecular weight of 262.37 g/mol. Its IUPAC name is methyl (2R)-2-[(2S)-1-ethylsulfanyl-1-oxopropan-2-yl]-2-hydroxy-4-methylpentanoate.
| Compound Name | methyl (2R)-2-[(2S)-1-ethylsulfanyl-1-oxopropan-2-yl]-2-hydroxy-4-methylpentanoate |
|---|---|
| PubChem CID | 134931699 |
| Molecular Formula | C12H22O4S |
| Molecular Weight | 262.37 g/mol |
| Exact Mass | 262.12 |
| IUPAC Name | methyl (2R)-2-[(2S)-1-ethylsulfanyl-1-oxopropan-2-yl]-2-hydroxy-4-methylpentanoate |
| SMILES | CCSC(=O)[C@@H](C)[C@](O)(CC(C)C)C(=O)OC |
| InChI | InChI=1S/C12H22O4S/c1-6-17-10(13)9(4)12(15,7-8(2)3)11(14)16-5/h8-9,15H,6-7H2,1-5H3/t9-,12-/m1/s1 |
| InChIKey | WVVPKFKEELKMSL-BXKDBHETSA-N |
| XLogP | 1.85 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.37 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|