C24H30O7P2S — CID 134931910
[(Z)-1-(cyclohexen-1-yl)-2-diphenoxyphosphorylsulfanylethenyl] diethyl phosphate (PubChem CID 134931910) has the molecular formula C24H30O7P2S and a molecular weight of 524.51 g/mol. Its IUPAC name is [(Z)-1-(cyclohexen-1-yl)-2-diphenoxyphosphorylsulfanylethenyl] diethyl phosphate.
| Compound Name | [(Z)-1-(cyclohexen-1-yl)-2-diphenoxyphosphorylsulfanylethenyl] diethyl phosphate |
|---|---|
| PubChem CID | 134931910 |
| Molecular Formula | C24H30O7P2S |
| Molecular Weight | 524.51 g/mol |
| Exact Mass | 524.12 |
| IUPAC Name | [(Z)-1-(cyclohexen-1-yl)-2-diphenoxyphosphorylsulfanylethenyl] diethyl phosphate |
| SMILES | CCOP(=O)(OCC)O/C(=C\SP(=O)(Oc1ccccc1)Oc1ccccc1)C1=CCCCC1 |
| InChI | InChI=1S/C24H30O7P2S/c1-3-27-32(25,28-4-2)31-24(21-14-8-5-9-15-21)20-34-33(26,29-22-16-10-6-11-17-22)30-23-18-12-7-13-19-23/h6-7,10-14,16-20H,3-5,8-9,15H2,1-2H3/b24-20- |
| InChIKey | CSGUAYPQGDQFSN-GFMRDNFCSA-N |
| XLogP | 8.53 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.51 |
| LogP ≤ 5 | 8.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|