C17H29O5PS — CID 134933099
S-[(Z)-2-(cyclohexen-1-yl)-2-diethoxyphosphoryloxyethenyl] 2,2-dimethylpropanethioate (PubChem CID 134933099) has the molecular formula C17H29O5PS and a molecular weight of 376.46 g/mol. Its IUPAC name is S-[(Z)-2-(cyclohexen-1-yl)-2-diethoxyphosphoryloxyethenyl] 2,2-dimethylpropanethioate.
| Compound Name | S-[(Z)-2-(cyclohexen-1-yl)-2-diethoxyphosphoryloxyethenyl] 2,2-dimethylpropanethioate |
|---|---|
| PubChem CID | 134933099 |
| Molecular Formula | C17H29O5PS |
| Molecular Weight | 376.46 g/mol |
| Exact Mass | 376.15 |
| IUPAC Name | S-[(Z)-2-(cyclohexen-1-yl)-2-diethoxyphosphoryloxyethenyl] 2,2-dimethylpropanethioate |
| SMILES | CCOP(=O)(OCC)O/C(=C\SC(=O)C(C)(C)C)C1=CCCCC1 |
| InChI | InChI=1S/C17H29O5PS/c1-6-20-23(19,21-7-2)22-15(14-11-9-8-10-12-14)13-24-16(18)17(3,4)5/h11,13H,6-10,12H2,1-5H3/b15-13- |
| InChIKey | ILIRWNRURJOXQV-SQFISAMPSA-N |
| XLogP | 5.83 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.46 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|