About (1S,6S)-7-thiatricyclo[4.3.1.01,6]deca-2,4,8-triene
(1S,6S)-7-thiatricyclo[4.3.1.01,6]deca-2,4,8-triene (PubChem CID 134932080) has the molecular formula C9H8S
and a molecular weight of 148.23 g/mol. Its IUPAC name is (1S,6S)-7-thiatricyclo[4.3.1.01,6]deca-2,4,8-triene.
Analyze (1S,6S)-7-thiatricyclo[4.3.1.01,6]deca-2,4,8-triene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S,6S)-7-thiatricyclo[4.3.1.01,6]deca-2,4,8-triene?
The IUPAC name of (1S,6S)-7-thiatricyclo[4.3.1.01,6]deca-2,4,8-triene (CID 134932080) is (1S,6S)-7-thiatricyclo[4.3.1.01,6]deca-2,4,8-triene.
What is the SMILES notation for (1S,6S)-7-thiatricyclo[4.3.1.01,6]deca-2,4,8-triene?
The canonical SMILES for (1S,6S)-7-thiatricyclo[4.3.1.01,6]deca-2,4,8-triene is C1=C[C@@]23C=CS[C@]2(C=C1)C3.
What is the InChIKey of (1S,6S)-7-thiatricyclo[4.3.1.01,6]deca-2,4,8-triene?
The InChIKey is XAUOENHUJAAAOC-DTWKUNHWSA-N. The full InChI is InChI=1S/C9H8S/c1-2-4-9-7-8(9,3-1)5-6-10-9/h1-6H,7H2/t8-,9+/m0/s1.
What are the key properties of (1S,6S)-7-thiatricyclo[4.3.1.01,6]deca-2,4,8-triene?
(1S,6S)-7-thiatricyclo[4.3.1.01,6]deca-2,4,8-triene has a molecular weight of 148.23 g/mol, XLogP of 2.50, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (1S,6S)-7-thiatricyclo[4.3.1.01,6]deca-2,4,8-triene is sourced from PubChem (CID 134932080), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).