C22H23N3O5 — CID 134932352
ethyl N-[5-benzoyl-4-ethyl-3-(4-methoxyphenyl)-2-oxoimidazol-1-yl]carbamate (PubChem CID 134932352) has the molecular formula C22H23N3O5 and a molecular weight of 409.44 g/mol. Its IUPAC name is ethyl N-[5-benzoyl-4-ethyl-3-(4-methoxyphenyl)-2-oxoimidazol-1-yl]carbamate.
| Compound Name | ethyl N-[5-benzoyl-4-ethyl-3-(4-methoxyphenyl)-2-oxoimidazol-1-yl]carbamate |
|---|---|
| PubChem CID | 134932352 |
| Molecular Formula | C22H23N3O5 |
| Molecular Weight | 409.44 g/mol |
| Exact Mass | 409.16 |
| IUPAC Name | ethyl N-[5-benzoyl-4-ethyl-3-(4-methoxyphenyl)-2-oxoimidazol-1-yl]carbamate |
| SMILES | CCOC(=O)Nn1c(C(=O)c2ccccc2)c(CC)n(-c2ccc(OC)cc2)c1=O |
| InChI | InChI=1S/C22H23N3O5/c1-4-18-19(20(26)15-9-7-6-8-10-15)25(23-21(27)30-5-2)22(28)24(18)16-11-13-17(29-3)14-12-16/h6-14H,4-5H2,1-3H3,(H,23,27) |
| InChIKey | MPSLGRAOQKUCBL-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 91.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.44 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |